For research use only. Not for therapeutic Use.
2-(2-Naphthyl)piperidine (CAT: L006150) is a synthetic compound with potential pharmacological applications. Its mode of action may involve interactions with neurotransmitter receptors or other cellular targets, potentially influencing physiological processes. While specific pharmacologic actions and applications can vary, compounds like this are often investigated for their potential roles in drug development, especially in the field of neuroscience or medicinal chemistry.
| Catalog Number | L006150 |
| CAS Number | 383128-73-2 |
| Molecular Formula | C15H17N |
| Purity | ≥95% |
| IUPAC Name | 2-naphthalen-2-ylpiperidine |
| InChI | InChI=1S/C15H17N/c1-2-6-13-11-14(9-8-12(13)5-1)15-7-3-4-10-16-15/h1-2,5-6,8-9,11,15-16H,3-4,7,10H2 |
| InChIKey | KIKVKRHNBPMOMC-UHFFFAOYSA-N |
