For research use only. Not for therapeutic Use.
2-(2-Nitro-1h-imidazol-1-yl)ethanamine hydrochloride (Cat.No:L004185) is a significant chemical compound with applications in pharmaceutical research. Its unique structure, incorporating a nitroimidazole group, imparts specialized reactivity and properties. This compound is utilized as a valuable intermediate in the synthesis of specialized organic molecules with potential pharmacological activity.
CAS Number | 116989-51-6 |
Molecular Formula | C5H9ClN4O2 |
Purity | ≥95% |
IUPAC Name | 2-(2-nitroimidazol-1-yl)ethanamine;hydrochloride |
InChI | InChI=1S/C5H8N4O2.ClH/c6-1-3-8-4-2-7-5(8)9(10)11;/h2,4H,1,3,6H2;1H |
InChIKey | UNLRFFXZTJXMPL-UHFFFAOYSA-N |
SMILES | C1=CN(C(=N1)[N+](=O)[O-])CCN.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |