For research use only. Not for therapeutic Use.
2-[(2-Nitrophenyl)thio]acetic Acid Hydrazide(Cat No.:R020998)is an organic compound studied for its potential applications in medicinal chemistry, particularly as an intermediate in synthesizing more complex molecules. The structure includes a nitrophenyl and thioether linkage, which contributes to its stability and reactivity, making it valuable in developing bioactive agents and drugs. It is explored in research as a building block for compounds with potential antimicrobial or anticancer properties. Additionally, its versatility in organic synthesis allows for further functional modifications, supporting its use in chemical research and drug development studies.
CAS Number | 4871-40-3 |
Synonyms | [(o-Nitrophenyl)thio]acetic Acid Hydrazide; [(2-nitrophenyl)thio]acetic Acid Hydrazide; |
Molecular Formula | C8H9N3O3S |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | 2-(2-nitrophenyl)sulfanylacetohydrazide |
InChI | InChI=1S/C8H9N3O3S/c9-10-8(12)5-15-7-4-2-1-3-6(7)11(13)14/h1-4H,5,9H2,(H,10,12) |
InChIKey | CZXFCCXLFQCYBK-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)[N+](=O)[O-])SCC(=O)NN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |