2-(2-Nitrophenyl)pyridine(Cat No.:L030800)is an important heterocyclic compound used as an intermediate in organic synthesis, particularly in the pharmaceutical and chemical research industries. This compound features a nitrophenyl group attached to the 2-position of the pyridine ring, making it valuable for the creation of complex molecules, including potential therapeutic agents. Its structure allows for versatile chemical modifications, including the formation of coordination complexes and other bioactive compounds. Its role as a building block in the synthesis of drugs and advanced materials makes it essential in medicinal chemistry and material science.
Catalog Number | L030800 |
CAS Number | 4253-81-0 |
Molecular Formula | C11H8N2O2 |
Purity | ≥95% |
IUPAC Name | 2-(2-nitrophenyl)pyridine |
InChI | InChI=1S/C11H8N2O2/c14-13(15)11-7-2-1-5-9(11)10-6-3-4-8-12-10/h1-8H |
InChIKey | VCWYADDAXFOQMH-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)C2=CC=CC=N2)[N+](=O)[O-] |