For research use only. Not for therapeutic Use.
2-(2-Propoxyethoxy)phenylboronic acid(CAT: L021399) is an organoboron compound commonly used in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions. This molecule features a phenyl ring substituted with a boronic acid group and a flexible 2-propoxyethoxy chain, which adds lipophilicity and potential solubility in organic solvents. The boronic acid functional group is highly reactive in forming C–C bonds with various aryl or vinyl halides, making it valuable in constructing complex molecular frameworks. This compound is often applied in the synthesis of bioactive molecules, pharmaceuticals, and advanced materials, where the boronic acid functionality allows for versatility in the development of therapeutic agents and specialty chemicals.
CAS Number | 279262-53-2 |
Molecular Formula | C11H17BO4 |
Purity | ≥95% |
IUPAC Name | [2-(2-propoxyethoxy)phenyl]boronic acid |
InChI | InChI=1S/C11H17BO4/c1-2-7-15-8-9-16-11-6-4-3-5-10(11)12(13)14/h3-6,13-14H,2,7-9H2,1H3 |
InChIKey | HHALCPBCKBNLFD-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |