Home
>
Chemical Reagents>Sulfonyl Chlorides> 2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzene-1-sulfonyl chloride
For research use only. Not for therapeutic Use.
2-(2,2-Difluoroethoxy)-6-(trifluoromethyl)benzene-1-sulfonyl chloride (Cat.No:L003708) is a crucial chemical compound with diverse applications in pharmaceutical and agrochemical industries. Its unique structure, featuring difluoroethoxy and trifluoromethyl groups, imparts valuable reactivity. This compound serves as a key intermediate in the synthesis of specialized materials and bioactive compounds.
CAS Number | 865352-01-8 |
Molecular Formula | C9H6ClF5O3S |
Purity | ≥95% |
IUPAC Name | 2-(2,2-difluoroethoxy)-6-(trifluoromethyl)benzenesulfonyl chloride |
InChI | InChI=1S/C9H6ClF5O3S/c10-19(16,17)8-5(9(13,14)15)2-1-3-6(8)18-4-7(11)12/h1-3,7H,4H2 |
InChIKey | DTNQLYAGRKNWMQ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)OCC(F)F)S(=O)(=O)Cl)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |