For research use only. Not for therapeutic Use.
2-(2,2-Dimethyl-1,3-dioxolan-4-yl)ethanol(Cat No.:L014693)is a high-purity compound widely used in pharmaceutical research and organic synthesis. This dioxolane derivative, featuring a hydroxyl group, serves as a versatile intermediate in the development of various bioactive molecules and complex chemical structures. Its unique combination of dioxolane and ethanol functionalities makes it valuable in medicinal chemistry, particularly in synthesizing potential therapeutic agents. 2-(2,2-Dimethyl-1,3-dioxolan-4-yl)ethanol is essential for research focused on exploring new synthetic pathways and optimizing chemical reactions.
Catalog Number | L014693 |
CAS Number | 5754-34-7 |
Molecular Formula | C7H14O3 |
Purity | ≥95% |
IUPAC Name | 2-(2,2-dimethyl-1,3-dioxolan-4-yl)ethanol |
InChI | InChI=1S/C7H14O3/c1-7(2)9-5-6(10-7)3-4-8/h6,8H,3-5H2,1-2H3 |
InChIKey | YYEZYENJAMOWHW-UHFFFAOYSA-N |
SMILES | CC1(OCC(O1)CCO)C |