For research use only. Not for therapeutic Use.
2-(2,2-Dimethylbenzo[d][1,3]dioxol-5-yl)acetic acid(Cat No.:L007423), is a chemical compound with the molecular formula C11H12O4. This compound is a member of the benzo[d][1,3]dioxole family, characterized by a benzene ring fused with a 1,3-dioxole ring. The presence of an acetic acid group suggests its potential utility in various chemical reactions, especially in the synthesis of more complex organic molecules.
CAS Number | 38515-59-2 |
Molecular Formula | C11H12O4 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 2-(2,2-dimethyl-1,3-benzodioxol-5-yl)acetic acid |
InChI | InChI=1S/C11H12O4/c1-11(2)14-8-4-3-7(6-10(12)13)5-9(8)15-11/h3-5H,6H2,1-2H3,(H,12,13) |
InChIKey | KKDDYOGGXRVNIQ-UHFFFAOYSA-N |
SMILES | CC1(OC2=C(O1)C=C(C=C2)CC(=O)O)C |