2-(2,3-dihydro-1H-isoindol-2-yl)ethan-1-amine dihydrochloride

For research use only. Not for therapeutic Use.

  • CAT Number: L007589
  • CAS Number: 1208452-70-3
  • Molecular Formula: C10H16Cl2N2
  • Molecular Weight: 235.15
  • Purity: ≥95%
Inquiry Now

2-(2,3-dihydro-1H-isoindol-2-yl)ethan-1-amine dihydrochloride(Cat No.:L007589), is a chemical compound featuring an ethylamine group attached to a dihydroisoindole ring structure. The dihydrochloride salt form enhances its solubility and stability. This compound holds significance in medicinal chemistry and drug discovery. Researchers explore its potential biological activities, aiming to understand its role in various physiological processes. Its unique structure allows for diverse chemical modifications, making it valuable in the synthesis of novel compounds for biological testing. Scientists leverage its properties to design new molecules for potential therapeutic applications, contributing to advancements in healthcare research.


CAS Number 1208452-70-3
Molecular Formula C10H16Cl2N2
Purity ≥95%
IUPAC Name 2-(1,3-dihydroisoindol-2-yl)ethanamine;dihydrochloride
InChI InChI=1S/C10H14N2.2ClH/c11-5-6-12-7-9-3-1-2-4-10(9)8-12;;/h1-4H,5-8,11H2;2*1H
InChIKey CVLGKVMEWCLNQG-UHFFFAOYSA-N
SMILES C1C2=CC=CC=C2CN1CCN.Cl.Cl
Chemistry Calculators Dilution Calculator
In vivo Formulation Calculator
Molarity Calculator
Molecular Weight Calculator
Reconstitution Calculator

Request a Quote