Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-(2,3-dihydro-1H-isoindol-2-yl)ethan-1-amine dihydrochloride
For research use only. Not for therapeutic Use.
2-(2,3-dihydro-1H-isoindol-2-yl)ethan-1-amine dihydrochloride(Cat No.:L007589), is a chemical compound featuring an ethylamine group attached to a dihydroisoindole ring structure. The dihydrochloride salt form enhances its solubility and stability. This compound holds significance in medicinal chemistry and drug discovery. Researchers explore its potential biological activities, aiming to understand its role in various physiological processes. Its unique structure allows for diverse chemical modifications, making it valuable in the synthesis of novel compounds for biological testing. Scientists leverage its properties to design new molecules for potential therapeutic applications, contributing to advancements in healthcare research.
Catalog Number | L007589 |
CAS Number | 1208452-70-3 |
Molecular Formula | C10H16Cl2N2 |
Purity | ≥95% |
IUPAC Name | 2-(1,3-dihydroisoindol-2-yl)ethanamine;dihydrochloride |
InChI | InChI=1S/C10H14N2.2ClH/c11-5-6-12-7-9-3-1-2-4-10(9)8-12;;/h1-4H,5-8,11H2;2*1H |
InChIKey | CVLGKVMEWCLNQG-UHFFFAOYSA-N |
SMILES | C1C2=CC=CC=C2CN1CCN.Cl.Cl |