For research use only. Not for therapeutic Use.
2’-(2,3-Epoxypropoxy)-3-phenylpropiophenone is an organic compound featuring an epoxy group and a phenyl moiety, making it significant in organic synthesis and materials science. This compound can serve as a photoinitiator in polymerization processes, particularly in UV-cured coatings and adhesives. Its unique structure allows for enhanced reactivity, facilitating the formation of cross-linked networks. Researchers explore its potential applications in developing advanced materials with specific properties, including improved mechanical strength and chemical resistance, highlighting its importance in industrial applications.
CAS Number | 22525-95-7 |
Synonyms | 1-[2-(Oxiranylmethoxy)phenyl]-3-phenyl-1-propanone; 2-[[2-(3-Phenylpropanoyl)phenoxy]methyl]oxirane; Propafenone Imp. C (EP) |
Molecular Formula | C18H18O3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 1-[2-(oxiran-2-ylmethoxy)phenyl]-3-phenylpropan-1-one |
InChI | InChI=1S/C18H18O3/c19-17(11-10-14-6-2-1-3-7-14)16-8-4-5-9-18(16)21-13-15-12-20-15/h1-9,15H,10-13H2 |
InChIKey | AUZMQKJKLUZHBY-UHFFFAOYSA-N |
SMILES | C1C(O1)COC2=CC=CC=C2C(=O)CCC3=CC=CC=C3 |