For research use only. Not for therapeutic Use.
2-(2′,3′,4′-Trihydroxybutyl)quinoxaline (Cat No.:C000895) is a chemical compound belonging to the quinoxaline family. It is characterized by a quinoxaline ring structure with a hydroxy butyl side chain. This compound is of interest due to its potential applications in medicinal chemistry and drug development. Its unique structure may impart desirable biological activities, making it a subject of research for its pharmacological properties.
| Catalog Number | C000895 |
| CAS Number | 118176-26-4 |
| Synonyms | 4-(2-quinoxalinyl)-1,2,3-Butanetriol |
| Molecular Formula | C₁₂H₁₄N₂O₃ |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Appearance | Off-White to Beige Solid |
| Storage | -20°C, Hygroscopic |
| IUPAC Name | (2R,3S)-4-quinoxalin-2-ylbutane-1,2,3-triol |
| InChI | InChI=1S/C12H14N2O3/c15-7-12(17)11(16)5-8-6-13-9-3-1-2-4-10(9)14-8/h1-4,6,11-12,15-17H,5,7H2/t11-,12+/m0/s1 |
| InChIKey | KFKHJQAEESRVHL-NWDGAFQWSA-N |
| SMILES | C1=CC=C2C(=C1)N=CC(=N2)CC(C(CO)O)O |
