For research use only. Not for therapeutic Use.
2-(2,4-Dichlorophenyl)acetamide (Cat.No:L003348) is a significant chemical compound in pharmaceutical research. Its distinct structure and properties make it a valuable scaffold for the development of novel pharmaceutical agents, underscoring its importance in modern drug discovery endeavors.
CAS Number | 55954-27-3 |
Molecular Formula | C8H7Cl2NO |
Purity | ≥95% |
IUPAC Name | 2-(2,4-dichlorophenyl)acetamide |
InChI | InChI=1S/C8H7Cl2NO/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4H,3H2,(H2,11,12) |
InChIKey | NAYAHQPYRSIGCX-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1Cl)Cl)CC(=O)N |