For research use only. Not for therapeutic Use.
2-(2,4-Difluorophenyl)-5-fluoropyridine(Cat No.:L007166), is a chemical compound with the molecular formula C11H6F3N. It consists of a pyridine ring substituted with fluorine atoms at the 5th and 2,4-fluorophenyl groups at the 2nd position. This compound is valuable in medicinal chemistry and drug discovery research, often utilized as a key intermediate for the synthesis of various biologically active molecules and pharmaceuticals. Its unique structure and reactivity enable its application in the development of potential therapeutic agents, making significant contributions to advancements in the field of drug development and the creation of novel chemical entities for various biological targets.
CAS Number | 1426047-01-9 |
Molecular Formula | C11H6F3N |
Purity | ≥95% |
IUPAC Name | 2-(2,4-difluorophenyl)-5-fluoropyridine |
InChI | InChI=1S/C11H6F3N/c12-7-1-3-9(10(14)5-7)11-4-2-8(13)6-15-11/h1-6H |
InChIKey | RKUQBAQVAGDVEX-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1F)F)C2=NC=C(C=C2)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |