For research use only. Not for therapeutic Use.
2-(2,4-Difluorophenyl)pyridine is a heterocyclic compound used in pharmaceutical research and organic synthesis. Featuring a pyridine ring attached to a difluorophenyl group at the 2-position, this compound is a valuable intermediate for the development of bioactive molecules, including drug candidates. Its fluorine atoms enhance the compound’s stability and reactivity, making it useful in the design of enzyme inhibitors, receptor modulators, and other therapeutic agents. It plays a significant role in advancing medicinal chemistry and the synthesis of complex organic compounds.
CAS Number | 391604-55-0 |
Molecular Formula | C11H7F2N |
Purity | ≥95% |
IUPAC Name | 2-(2,4-difluorophenyl)pyridine |
InChI | InChI=1S/C11H7F2N/c12-8-4-5-9(10(13)7-8)11-3-1-2-6-14-11/h1-7H |
InChIKey | SSABEFIRGJISFH-UHFFFAOYSA-N |