For research use only. Not for therapeutic Use.
2,2′:5′,2”-Terthiophene-5,5”-dicarboxylic acid(CAT: M053190) is a chemical compound with a specific arrangement of thiophene rings and carboxylic acid functional groups. Its mode of action and pharmacological effects are not explicitly documented in the provided information. The compound’s structure suggests it could potentially be used as a building block in organic synthesis for creating more complex molecules, particularly for materials, polymers, or other specialized applications.
| Catalog Number | M053190 |
| CAS Number | 13130-50-2 |
| Molecular Formula | C14H8O2S3 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 5-[5-(5-formylthiophen-2-yl)thiophen-2-yl]thiophene-2-carbaldehyde |
| InChI | InChI=1S/C14H8O2S3/c15-7-9-1-3-11(17-9)13-5-6-14(19-13)12-4-2-10(8-16)18-12/h1-8H |
| InChIKey | YAEGPDBHSBKYRW-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1)C2=CC=C(S2)C3=CC=C(S3)C=O)C=O |
