Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
2-(2,6-Dioxopiperidin-3-yl)-5-fluoro-6-(piperazin-1-yl)isoindoline-1,3-dione
For research use only. Not for therapeutic Use.
2-(2,6-Dioxopiperidin-3-yl)-5-fluoro-6-(piperazin-1-yl)isoindoline-1,3-dione(CAT: L000075) is a significant compound in the fields of pharmaceutical and organic chemistry. This chemical structure comprises an isoindoline-1,3-dione core with a piperidinone and piperazinyl groups, making it a crucial intermediate for the synthesis of complex organic molecules. It plays a vital role in drug discovery and medicinal chemistry, enabling the development of diverse pharmaceutical agents.
Catalog Number | L000075 |
CAS Number | 2222114-22-7 |
Molecular Formula | C17H17FN4O4 |
Purity | ≥95% |
Target | Autophagy |
IUPAC Name | 2-(2,6-dioxopiperidin-3-yl)-5-fluoro-6-piperazin-1-ylisoindole-1,3-dione |
InChI | InChI=1S/C17H17FN4O4/c18-11-7-9-10(8-13(11)21-5-3-19-4-6-21)17(26)22(16(9)25)12-1-2-14(23)20-15(12)24/h7-8,12,19H,1-6H2,(H,20,23,24) |
InChIKey | YNGDWIBEYDEYGU-UHFFFAOYSA-N |