For research use only. Not for therapeutic Use.
2-(2H-Benzo[d][1,2,3]triazol-2-yl)ethanamine is a heterocyclic compound featuring a benzotriazole moiety linked to an ethylamine group. This compound is of interest in medicinal chemistry due to its potential biological activities, including antimicrobial, antifungal, and anticancer properties. The benzotriazole structure enhances its ability to interact with various biological targets, making it a valuable scaffold for drug development. Its unique features allow for further modifications, facilitating the exploration of novel therapeutic agents and expanding applications in pharmaceutical research.
CAS Number | 69980-83-2 |
Molecular Formula | C8H10N4 |
Purity | ≥95% |
IUPAC Name | 2-(benzotriazol-2-yl)ethanamine |
InChI | InChI=1S/C8H10N4/c9-5-6-12-10-7-3-1-2-4-8(7)11-12/h1-4H,5-6,9H2 |
InChIKey | INACWHUYXXAULT-UHFFFAOYSA-N |
SMILES | C1=CC2=NN(N=C2C=C1)CCN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |