For research use only. Not for therapeutic Use.
2-(3-Benzoylphenyl)-N-benzylpropanamide(Cat No.:L002647)is an organic compound used in pharmaceutical research and development as a building block for synthesizing bioactive molecules. The presence of a benzoyl group attached to the phenyl ring, along with the benzyl-propanamide framework, allows for diverse chemical modifications, making it a versatile intermediate in drug design. This compound’s structure suggests potential applications in creating compounds with analgesic, anti-inflammatory, or other therapeutic properties. It is particularly valuable in medicinal chemistry for exploring new therapeutic agents with improved efficacy and specificity.
CAS Number | 166407-85-8 |
Molecular Formula | C23H21NO2 |
Purity | ≥95% |
IUPAC Name | 2-(3-benzoylphenyl)-N-benzylpropanamide |
InChI | InChI=1S/C23H21NO2/c1-17(23(26)24-16-18-9-4-2-5-10-18)20-13-8-14-21(15-20)22(25)19-11-6-3-7-12-19/h2-15,17H,16H2,1H3,(H,24,26) |
InChIKey | AJGQOQSLVOTFPI-UHFFFAOYSA-N |
SMILES | CC(C1=CC(=CC=C1)C(=O)C2=CC=CC=C2)C(=O)NCC3=CC=CC=C3 |