For research use only. Not for therapeutic Use.
2-(3-(Benzyloxy)propyl)propane-1,3-diol(CAT: L000266)is a valuable chemical compound in the field of organic chemistry. It is known for its role as a versatile building block in the synthesis of various organic compounds. This compound serves as an intermediate in the creation of complex molecules due to its ability to undergo various chemical reactions, making it a pivotal component in organic synthesis.
Catalog Number | L000266 |
CAS Number | 132970-27-5 |
Molecular Formula | C13H20O3 |
Purity | ≥95% |
IUPAC Name | 2-(3-phenylmethoxypropyl)propane-1,3-diol |
InChI | InChI=1S/C13H20O3/c14-9-13(10-15)7-4-8-16-11-12-5-2-1-3-6-12/h1-3,5-6,13-15H,4,7-11H2 |
InChIKey | RZXJFSQQRBRPBQ-UHFFFAOYSA-N |