For research use only. Not for therapeutic Use.
2-(3-Bromo-1H-pyrazol-1-yl)pyridine(CAT: L018913) is a heterocyclic compound frequently used as a building block in medicinal chemistry and organic synthesis. This molecule combines a brominated pyrazole ring with a pyridine moiety, providing a scaffold that enables diverse functionalization, especially in cross-coupling reactions. The bromine atom at the 3-position of the pyrazole ring enhances reactivity, allowing for further derivatization and facilitating the construction of complex molecular structures. 2-(3-Bromo-1H-pyrazol-1-yl)pyridine is particularly useful in developing kinase inhibitors, receptor modulators, and other bioactive compounds in pharmaceutical research, making it a versatile intermediate for drug discovery and chemical research.
CAS Number | 1622839-24-0 |
Molecular Formula | C8H6BrN3 |
Purity | ≥95% |
IUPAC Name | 2-(3-bromopyrazol-1-yl)pyridine |
InChI | InChI=1S/C8H6BrN3/c9-7-4-6-12(11-7)8-3-1-2-5-10-8/h1-6H |
InChIKey | VLXFMEWTXMTUOF-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |