For research use only. Not for therapeutic Use.
2-(3-Bromo-5-chlorophenyl)acetonitrile is an organic compound featuring a phenyl ring with bromine at the 3-position and chlorine at the 5-position, linked to an acetonitrile group (-CH₂CN) at the 2-position. The halogen substitutions on the aromatic ring enhance the compound’s reactivity, making it suitable for various chemical transformations. This structure is often used as an intermediate in organic synthesis, particularly in the production of pharmaceuticals, agrochemicals, and other bioactive compounds with potential antimicrobial or anticancer properties.
Catalog Number | L032929 |
CAS Number | 1056454-88-6 |
Molecular Formula | C8H5BrClN |
Purity | ≥95% |
IUPAC Name | 2-(3-bromo-5-chlorophenyl)acetonitrile |
InChI | InChI=1S/C8H5BrClN/c9-7-3-6(1-2-11)4-8(10)5-7/h3-5H,1H2 |
InChIKey | MNLUEMZAOJCLTR-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1Cl)Br)CC#N |