For research use only. Not for therapeutic Use.
2-(3-Bromo-5-methoxyphenyl)acetonitrile(Cat No.:L006785). It features a phenyl acetonitrile backbone substituted with a bromine atom at the 3-position and a methoxy group at the 5-position of the phenyl ring. This compound is significant in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals. Its unique structure enables diverse chemical transformations, making it valuable in the design and synthesis of complex molecules.
Catalog Number | L006785 |
CAS Number | 123018-27-9 |
Molecular Formula | C9H8BrNO |
Purity | ≥95% |
IUPAC Name | 2-(3-bromo-5-methoxyphenyl)acetonitrile |
InChI | InChI=1S/C9H8BrNO/c1-12-9-5-7(2-3-11)4-8(10)6-9/h4-6H,2H2,1H3 |
InChIKey | IVKIDNUBLJFKNF-UHFFFAOYSA-N |
SMILES | COC1=CC(=CC(=C1)CC#N)Br |