For research use only. Not for therapeutic Use.
2-(3-Chlorophenoxy)-propionic acid(Cat No.:M067908), also known as fenoprop, is a chemical compound with the molecular formula C9H9ClO3. It consists of a propionic acid backbone with a 3-chlorophenoxy group attached to the second carbon atom. Fenoprop is commonly used as a herbicide, primarily targeting broadleaf weeds in agricultural and horticultural settings. It works by inhibiting the growth of unwanted plants by disrupting their cellular processes, ultimately leading to their death. Fenoprop is known for its selective herbicidal activity, effectively controlling weeds while minimizing harm to desirable crops.
CAS Number | 101-10-0 |
Molecular Formula | C9H9ClO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(3-chlorophenoxy)propanoic acid |
InChI | InChI=1S/C9H9ClO3/c1-6(9(11)12)13-8-4-2-3-7(10)5-8/h2-6H,1H3,(H,11,12) |
InChIKey | YNTJKQDWYXUTLZ-UHFFFAOYSA-N |
SMILES | CC(C(=O)O)OC1=CC(=CC=C1)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |