Home
>
Chemical Reagents>Organic Building Blocks> 2-(3-Cyclopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
For research use only. Not for therapeutic Use.
2-(3-Cyclopropoxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane(Cat No.:L007244), is a chemical compound valuable in organic synthesis and medicinal chemistry. This compound contains a boron atom within a dioxaborolane ring, providing unique reactivity and selectivity in cross-coupling reactions. Researchers use it as a boronic ester building block for the synthesis of complex organic molecules, including pharmaceuticals. The presence of the cyclopropoxyphenyl group enhances its reactivity and allows for diverse modifications. Its applications contribute to the creation of novel drug candidates and advanced organic materials, making it essential in the field of chemical research.
CAS Number | 1035690-24-4 |
Molecular Formula | C15H21BO3 |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 2-(3-cyclopropyloxyphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
InChI | InChI=1S/C15H21BO3/c1-14(2)15(3,4)19-16(18-14)11-6-5-7-13(10-11)17-12-8-9-12/h5-7,10,12H,8-9H2,1-4H3 |
InChIKey | QRRJFVBHNJSHKB-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)OC3CC3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |