For research use only. Not for therapeutic Use.
2,3-Dimyristoyl-sn-glycerol (Cat No.:M071315) is a glycerophospholipid composed of a glycerol backbone esterified with two myristic acid chains at the sn-1 and sn-2 positions. It is a major component of cell membranes, contributing to their structural integrity and fluidity. DMG plays a crucial role in cellular processes such as membrane trafficking, signal transduction, and lipid metabolism. Additionally, it serves as a precursor for the synthesis of other phospholipids and lipid-derived signaling molecules.
Catalog Number | M071315 |
CAS Number | 1069-82-5 |
Molecular Formula | C31H60O5 |
Purity | ≥95% |
Storage | 3 years -20C powder |
IUPAC Name | [(2R)-3-hydroxy-2-tetradecanoyloxypropyl] tetradecanoate |
InChI | InChI=1S/C31H60O5/c1-3-5-7-9-11-13-15-17-19-21-23-25-30(33)35-28-29(27-32)36-31(34)26-24-22-20-18-16-14-12-10-8-6-4-2/h29,32H,3-28H2,1-2H3/t29-/m1/s1 |
InChIKey | JFBCSFJKETUREV-GDLZYMKVSA-N |
SMILES | CCCCCCCCCCCCCC(=O)OCC(CO)OC(=O)CCCCCCCCCCCCC |