For research use only. Not for therapeutic Use.
2-(3-Fluoro-2-methylphenyl)acetonitrile is an aromatic nitrile compound featuring a phenyl ring substituted with a fluoro group at the 3-position and a methyl group at the 2-position. The acetonitrile functional group adds to its reactivity, making it useful in organic synthesis and medicinal chemistry. This compound can serve as an important intermediate for the development of pharmaceuticals and agrochemicals. Its unique structure allows for various chemical transformations, facilitating the exploration of structure-activity relationships in chemical research and drug development.
CAS Number | 500912-15-2 |
Molecular Formula | C9H8FN |
Purity | ≥95% |
IUPAC Name | 2-(3-fluoro-2-methylphenyl)acetonitrile |
InChI | InChI=1S/C9H8FN/c1-7-8(5-6-11)3-2-4-9(7)10/h2-4H,5H2,1H3 |
InChIKey | AYTNRVRHECGBPZ-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC=C1F)CC#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |