Home
>
Chemical Reagents>Heterocyclic Building Blocks>
>
2-(3-Fluoropyridin-4-yl)propan-2-amine hydrochloride
For research use only. Not for therapeutic Use.
2-(3-Fluoropyridin-4-yl)propan-2-amine hydrochloride (Cat.No:L003929) is a significant chemical compound in pharmaceutical research. Its distinctive structure, featuring a fluoropyridine and amine group, imparts unique pharmacological properties. This compound is employed as a crucial intermediate in the synthesis of specialized pharmaceutical agents, highlighting its importance in drug development processes.
Catalog Number | L003929 |
CAS Number | 2442597-47-7 |
Molecular Formula | C8H12ClFN2 |
Purity | ≥95% |
IUPAC Name | 2-(3-fluoropyridin-4-yl)propan-2-amine;hydrochloride |
InChI | InChI=1S/C8H11FN2.ClH/c1-8(2,10)6-3-4-11-5-7(6)9;/h3-5H,10H2,1-2H3;1H |
InChIKey | AFAXOWRTIBXJDQ-UHFFFAOYSA-N |
SMILES | CC(C)(C1=C(C=NC=C1)F)N.Cl |