For research use only. Not for therapeutic Use.
2-(3-Hydroxy-4-nitrophenyl)acetic acid is an aromatic compound featuring a nitrophenyl group and a hydroxyl group at the 3-position, along with an acetic acid moiety. This compound is significant in organic synthesis and medicinal chemistry, serving as an intermediate for various bioactive molecules. The nitro group contributes to potential biological activities, including anti-inflammatory and antimicrobial properties. Its unique structure allows for further functionalization, making it valuable in the development of new therapeutic agents and in exploring various chemical applications.
CAS Number | 152148-79-3 |
Molecular Formula | C8H7NO5 |
Purity | ≥95% |
IUPAC Name | 2-(3-hydroxy-4-nitrophenyl)acetic acid |
InChI | InChI=1S/C8H7NO5/c10-7-3-5(4-8(11)12)1-2-6(7)9(13)14/h1-3,10H,4H2,(H,11,12) |
InChIKey | USYXXSPSICUYRL-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1CC(=O)O)O)[N+](=O)[O-] |