For research use only. Not for therapeutic Use.
2-(3-Methoxyphenyl)-1,3,2-dioxaborinane(CAT: L000404) is a valuable compound that finds applications primarily in the field of material chemistry. This boron-containing organic molecule serves as a key component in the synthesis of advanced organic polymers and materials. Its boron moiety is instrumental in enhancing the thermal and electronic properties of polymers, making it essential in the development of high-performance materials.
CAS Number | 416839-37-7 |
Molecular Formula | C10H13BO3 |
Purity | ≥95% |
IUPAC Name | 2-(3-methoxyphenyl)-1,3,2-dioxaborinane |
InChI | InChI=1S/C10H13BO3/c1-12-10-5-2-4-9(8-10)11-13-6-3-7-14-11/h2,4-5,8H,3,6-7H2,1H3 |
InChIKey | GNYXSKRQIVSGLL-UHFFFAOYSA-N |