For research use only. Not for therapeutic Use.
2-(3-Nitrophenyl)-1,3,2-dioxaborinane(CAT: L000106) is a crucial compound in material chemistry and organic synthesis. This chemical serves as a versatile building block for the creation of organic electronic materials and functional molecules. Its unique structure makes it valuable in the design and synthesis of materials used in organic light-emitting diodes (OLEDs), organic photovoltaics, and other optoelectronic devices.
CAS Number | 85107-44-4 |
Molecular Formula | C9H10BNO4 |
Purity | ≥95% |
IUPAC Name | 2-(3-nitrophenyl)-1,3,2-dioxaborinane |
InChI | InChI=1S/C9H10BNO4/c12-11(13)9-4-1-3-8(7-9)10-14-5-2-6-15-10/h1,3-4,7H,2,5-6H2 |
InChIKey | KQUHPUDVXJTDHA-UHFFFAOYSA-N |