Home
>
Chemical Reagents>Organic Building Blocks> 2-(3-oxo-2,3-Dihydro-1H-cyclopenta[b]naphthalen-1-ylidene)malononitrile
For research use only. Not for therapeutic Use.
2-(3-Oxo-2,3-dihydro-1H-cyclopenta[b]naphthalen-1-ylidene)malononitrile(Cat No.:L002636)is a specialized organic compound used in advanced materials science and pharmaceutical research. This molecule features a cyclopenta[b]naphthalene core with a keto group and a malononitrile moiety, making it valuable for synthesizing complex molecular architectures. It is often employed in the development of organic semiconductors, dyes, and bioactive compounds due to its conjugated structure and electron-withdrawing nitrile groups. This compound’s unique properties support research in optoelectronics, medicinal chemistry, and the design of functional materials.
CAS Number | 2109805-70-9 |
Molecular Formula | C16H8N2O |
Purity | ≥95% |
IUPAC Name | 2-(3-oxocyclopenta[b]naphthalen-1-ylidene)propanedinitrile |
InChI | InChI=1S/C16H8N2O/c17-8-12(9-18)13-7-16(19)15-6-11-4-2-1-3-10(11)5-14(13)15/h1-6H,7H2 |
InChIKey | UYSZYWIPEGBWIR-UHFFFAOYSA-N |
SMILES | C1C(=C(C#N)C#N)C2=CC3=CC=CC=C3C=C2C1=O |