For research use only. Not for therapeutic Use.
2-(3-Pyrazin-2-yl-1,2,4-oxadiazol-5-yl)ethanohydrazide is a bioactive compound that features a unique combination of pyrazine and oxadiazole moieties. This structure suggests potential applications in medicinal chemistry, particularly as an antimicrobial or anticancer agent. The compound’s hydrazide functionality may contribute to its reactivity and ability to interact with biological targets. Research is ongoing to explore its pharmacological properties, optimize its efficacy, and understand its mechanisms of action, highlighting its promise in developing novel therapeutic agents.
Catalog Number | M041234 |
CAS Number | 175203-77-7 |
Molecular Formula | C8H8N6O2 |
Purity | ≥95% |
Storage | Desiccate at -20 ℃ |
IUPAC Name | 2-(3-pyrazin-2-yl-1,2,4-oxadiazol-5-yl)acetohydrazide |
InChI | InChI=1S/C8H8N6O2/c9-13-6(15)3-7-12-8(14-16-7)5-4-10-1-2-11-5/h1-2,4H,3,9H2,(H,13,15) |
InChIKey | OBZQEORKTFGMFT-UHFFFAOYSA-N |
SMILES | C1=CN=C(C=N1)C2=NOC(=N2)CC(=O)NN |