For research use only. Not for therapeutic Use.
2-(3,4-dihydroxyphenyl)-2-hydroxy-acetaldehyde(Cat No.:M065743), also known as dihydroxyacetone (DHA), is a simple carbohydrate and a key intermediate in various biochemical pathways. It is notably involved in the glycolysis pathway, where it undergoes enzymatic conversion to yield glyceraldehyde-3-phosphate, a crucial precursor in energy metabolism. Additionally, DHA plays a pivotal role in the biosynthesis of complex carbohydrates and lipids in living organisms.
CAS Number | 13023-73-9 |
Molecular Formula | C8H8O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(3,4-dihydroxyphenyl)-2-hydroxyacetaldehyde |
InChI | InChI=1S/C8H8O4/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-4,8,10-12H |
InChIKey | YUGMCLJIWGEKCK-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1C(C=O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |