Home
>
Chemical Reagents>Organometallic Reagents> 2-(3,5-Dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
For research use only. Not for therapeutic Use.
2-(3,5-Dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane(Cat No.:L027135)is a specialized boronic ester widely used in organic synthesis, particularly in Suzuki-Miyaura cross-coupling reactions. Featuring a dibromophenyl group and a dioxaborolane ring, this compound is crucial for constructing complex molecular architectures in pharmaceutical and materials science research. Its unique structure allows for precise chemical modifications, enabling the development of advanced materials and new therapeutic agents. 2-(3,5-Dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is essential for high-precision synthesis and innovative research in organic chemistry.
CAS Number | 408492-26-2 |
Molecular Formula | C12H15BBr2O2 |
Purity | ≥95% |
IUPAC Name | 2-(3,5-dibromophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
InChI | InChI=1S/C12H15BBr2O2/c1-11(2)12(3,4)17-13(16-11)8-5-9(14)7-10(15)6-8/h5-7H,1-4H3 |
InChIKey | WJYKUCWENIHKOC-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC(=C2)Br)Br |