For research use only. Not for therapeutic Use.
2-[(4-(1-Methylethyl)phenyl)-phenyl-acetyl]-1H-indan-1,3-dione (Cat No.:M019746) is a chemical compound. It consists of an indan-1,3-dione core bearing a complex aryl acetyl group. This compound holds significance in medicinal chemistry and drug development due to its potential biological activities. Its structural complexity offers opportunities for tailored interactions with biological targets. Compounds with similar scaffolds might exhibit diverse pharmacological properties. This compound’s role as a synthetic intermediate contributes to the exploration of structurally diverse molecules for pharmaceutical and research purposes, potentially leading to the discovery of novel therapeutic agents.
CAS Number | 122916-79-4 |
Synonyms | 2-[(4-(1-Methylethyl)phenyl)-phenyl-acetyl]-1H-indan-1,3-dion |
Molecular Formula | C26H22O3 |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | 2-[2-phenyl-2-(4-propan-2-ylphenyl)acetyl]indene-1,3-dione |
InChI | InChI=1S/C26H22O3/c1-16(2)17-12-14-19(15-13-17)22(18-8-4-3-5-9-18)26(29)23-24(27)20-10-6-7-11-21(20)25(23)28/h3-16,22-23H,1-2H3 |
InChIKey | LTOWHDDMSDCWDE-UHFFFAOYSA-N |
SMILES | CC(C)C1=CC=C(C=C1)C(C2=CC=CC=C2)C(=O)C3C(=O)C4=CC=CC=C4C3=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |