Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-(4-(1,2,2-Triphenylvinyl)phenoxy)acetic acid
For research use only. Not for therapeutic Use.
2-(4-(1,2,2-Triphenylvinyl)phenoxy)acetic acid (Cat.No:L004127) is a significant compound in organic synthesis. Its distinct structure incorporates a triphenylvinyl group and phenoxyacetic acid, offering unique reactivity. This compound serves as a valuable building block for the creation of specialized molecules with diverse applications in pharmaceutical and chemical research.
Catalog Number | L004127 |
CAS Number | 1471339-65-7 |
Molecular Formula | C28H22O3 |
Purity | ≥95% |
IUPAC Name | 2-[4-(1,2,2-triphenylethenyl)phenoxy]acetic acid |
InChI | InChI=1S/C28H22O3/c29-26(30)20-31-25-18-16-24(17-19-25)28(23-14-8-3-9-15-23)27(21-10-4-1-5-11-21)22-12-6-2-7-13-22/h1-19H,20H2,(H,29,30) |
InChIKey | GOFIMUDMXZWRPY-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=C(C=C3)OCC(=O)O)C4=CC=CC=C4 |