Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-(4-(4-Chlorophenyl)-2-oxopyrrolidin-1-yl)acetamide
For research use only. Not for therapeutic Use.
2-(4-(4-Chlorophenyl)-2-oxopyrrolidin-1-yl)acetamide (Cat.No:L003915) is a significant compound in medicinal chemistry. Its unique structure, containing a pyrrolidinone ring and a chlorophenyl group, offers diverse pharmacological potential. This compound serves as a crucial scaffold in the development of bioactive molecules, particularly in the field of pharmaceuticals.
CAS Number | 213178-69-9 |
Molecular Formula | C12H13ClN2O2 |
Purity | ≥95% |
IUPAC Name | 2-[4-(4-chlorophenyl)-2-oxopyrrolidin-1-yl]acetamide |
InChI | InChI=1S/C12H13ClN2O2/c13-10-3-1-8(2-4-10)9-5-12(17)15(6-9)7-11(14)16/h1-4,9H,5-7H2,(H2,14,16) |
InChIKey | NEEZTPLBDJRDCV-UHFFFAOYSA-N |
SMILES | C1C(CN(C1=O)CC(=O)N)C2=CC=C(C=C2)Cl |