Home
>
Reference Standards>Parasite> 2-[[4-[(7-Chloroquinolin-4-yl)amino]pentyl](ethyl)amino]ethanol
For research use only. Not for therapeutic Use.
2-[4-[(7-Chloroquinolin-4-yl)amino]pentylamino]ethanol(Cat No.:M067112)is a synthetic compound structurally related to chloroquine, a well-known antimalarial drug. This compound exhibits activity against Plasmodium species by interfering with heme detoxification in the parasite’s food vacuole, leading to parasite death. Its unique structure may also lend itself to research exploring antimalarial resistance mechanisms and therapeutic optimization. Additionally, the compound is of interest in studying potential anti-inflammatory and antiviral effects due to its structural similarity to other quinoline derivatives, supporting its relevance in medicinal chemistry and infectious disease research.
Catalog Number | M067112 |
CAS Number | 118-42-3 |
Molecular Formula | C18H26ClN3O |
Purity | ≥95% |
Target | Immunology/Inflammation |
Storage | -20°C |
IUPAC Name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol |
InChI | InChI=1S/C18H26ClN3O/c1-3-22(11-12-23)10-4-5-14(2)21-17-8-9-20-18-13-15(19)6-7-16(17)18/h6-9,13-14,23H,3-5,10-12H2,1-2H3,(H,20,21) |
InChIKey | XXSMGPRMXLTPCZ-UHFFFAOYSA-N |
SMILES | CCN(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCO |