For research use only. Not for therapeutic Use.
2-(4-Amino-3-methylphenyl)acetic acid is an amino acid derivative characterized by an amino group and a methyl substitution on a phenyl ring at the 4-position, along with an acetic acid moiety. This compound is significant in medicinal chemistry due to its potential biological activities, including anti-inflammatory and analgesic effects. The amino and carboxylic acid functional groups contribute to its solubility and reactivity, allowing for diverse chemical transformations. Its unique structure makes it valuable in the synthesis of novel therapeutic agents and bioactive compounds.
CAS Number | 705240-99-9 |
Molecular Formula | C9H11NO2 |
Purity | ≥95% |
IUPAC Name | 2-(4-amino-3-methylphenyl)acetic acid |
InChI | InChI=1S/C9H11NO2/c1-6-4-7(5-9(11)12)2-3-8(6)10/h2-4H,5,10H2,1H3,(H,11,12) |
InChIKey | LTCIAYCHYFURKB-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1)CC(=O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |