For research use only. Not for therapeutic Use.
2-(4-Aminobenzyl)pyridine（Cat No.:L039983）is a versatile compound used as an intermediate in the synthesis of pharmaceuticals and organic materials. This compound features a benzyl group with an amino substituent at the 4-position attached to the 2-position of a pyridine ring. Its structure allows for diverse chemical modifications, making it valuable in the development of bioactive molecules, including drug candidates and ligands for coordination chemistry. It plays a crucial role in medicinal chemistry, facilitating the creation of compounds with potential therapeutic applications and advancing drug discovery efforts.
| Catalog Number | L039983 |
| CAS Number | 58498-12-7 |
| Molecular Formula | C12H12N2 |
| Purity | ≥95% |
| IUPAC Name | 4-(pyridin-2-ylmethyl)aniline |
| InChI | InChI=1S/C12H12N2/c13-11-6-4-10(5-7-11)9-12-3-1-2-8-14-12/h1-8H,9,13H2 |
| InChIKey | UTLDQPSPINRRLM-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)CC2=CC=C(C=C2)N |
