For research use only. Not for therapeutic Use.
2-[4-(Aminomethyl)phenoxy]ethan-1-ol hydrochloride(Cat No.:L007237), is a chemical compound with significance in medicinal chemistry and pharmaceutical research. It contains a phenyl group substituted with an aminomethyl moiety and a hydroxyethyl group. The compound’s hydrochloride form enhances its solubility and stability, making it valuable for biological studies. Researchers use this compound as a key intermediate in the synthesis of diverse organic molecules, including potential drugs and pharmacologically active compounds. Its unique structure allows for modifications, enabling the design of novel bioactive agents and contributing to drug discovery efforts and advancements in medicinal chemistry research.
CAS Number | 1221725-65-0 |
Molecular Formula | C9H14ClNO2 |
Purity | ≥95% |
IUPAC Name | 2-[4-(aminomethyl)phenoxy]ethanol;hydrochloride |
InChI | InChI=1S/C9H13NO2.ClH/c10-7-8-1-3-9(4-2-8)12-6-5-11;/h1-4,11H,5-7,10H2;1H |
InChIKey | JTRQYTLFYKMXNA-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CN)OCCO.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |