For research use only. Not for therapeutic Use.
2-(4-(Aminomethyl)phenyl)acetic Acid Hydrochloride(CAT: L037759) is a high-purity compound frequently utilized in pharmaceutical and chemical research. Featuring an aminomethyl group on a phenylacetic acid backbone, this hydrochloride salt provides excellent solubility and stability, making it a valuable intermediate for the synthesis of bioactive molecules and complex organic compounds. Its versatile structure supports diverse applications in drug discovery, medicinal chemistry, and biochemical studies. 2-(4-(Aminomethyl)phenyl)acetic Acid Hydrochloride offers consistent performance, enabling precise incorporation into chemical pathways and facilitating innovative research in advanced therapeutic and industrial developments.
CAS Number | 42383-05-1 |
Molecular Formula | C9H12ClNO2 |
Purity | ≥95% |
IUPAC Name | 2-[4-(aminomethyl)phenyl]acetic acid;hydrochloride |
InChI | InChI=1S/C9H11NO2.ClH/c10-6-8-3-1-7(2-4-8)5-9(11)12;/h1-4H,5-6,10H2,(H,11,12);1H |
InChIKey | PJDXJVFXKIXEGW-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CC(=O)O)CN.Cl |