Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2-[4-(Aminomethyl)piperidin-1-yl]acetonitrile dihydrochloride
For research use only. Not for therapeutic Use.
2-[4-(Aminomethyl)piperidin-1-yl]acetonitrile dihydrochloride(Cat No.:L007388), is a significant chemical compound widely employed in medicinal chemistry and pharmaceutical research. This dihydrochloride salt features a piperidine ring with aminomethyl and nitrile groups, making it valuable for drug development. Researchers utilize this compound to synthesize potential therapeutic agents, especially those targeting the central nervous system. The compound’s structural properties and reactivity contribute to its applications in neuroscience research and the discovery of novel medications, showcasing its importance in advancing pharmaceutical science.
Catalog Number | L007388 |
CAS Number | 1354953-43-7 |
Molecular Formula | C8H17Cl2N3 |
Purity | ≥95% |
IUPAC Name | 2-[4-(aminomethyl)piperidin-1-yl]acetonitrile;dihydrochloride |
InChI | InChI=1S/C8H15N3.2ClH/c9-3-6-11-4-1-8(7-10)2-5-11;;/h8H,1-2,4-7,10H2;2*1H |
InChIKey | LQVWBOVZEOLNIM-UHFFFAOYSA-N |
SMILES | C1CN(CCC1CN)CC#N.Cl.Cl |