For research use only. Not for therapeutic Use.
2-(4-Aminophenyl)-6-tert-butyl-1H-pyrazolo[1,5-b][1,2,4]triazole(Cat No.:M097417) is a synthetic heterocyclic compound combining structural elements of pyrazole and triazole rings. This compound features a 4-aminophenyl group at the second position and a tert-butyl group at the sixth position. Such molecular architecture is typically investigated for potential pharmacological activities, including acting as enzyme inhibitors or receptor modulators. The aminophenyl group could facilitate interactions with biological targets, while the bulky tert-butyl group may enhance the molecule’s stability and lipophilicity, affecting its pharmacokinetic properties and making it a candidate for further drug development studies.
CAS Number | 152828-25-6 |
Molecular Formula | C14H17N5 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 4-(6-tert-butyl-5H-pyrazolo[1,5-b][1,2,4]triazol-2-yl)aniline |
InChI | InChI=1S/C14H17N5/c1-14(2,3)11-8-12-16-13(18-19(12)17-11)9-4-6-10(15)7-5-9/h4-8,17H,15H2,1-3H3 |
InChIKey | YSZXPOQOSPQIFI-UHFFFAOYSA-N |
SMILES | CC(C)(C)C1=CC2=NC(=NN2N1)C3=CC=C(C=C3)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |