For research use only. Not for therapeutic Use.
2-(4-Aminophenyl)ethanol (Cat.No:M071339) is a chemical compound used in various industrial and pharmaceutical applications. It contains an amino group and a hydroxyl group, making it valuable as a building block in the synthesis of pharmaceuticals, dyes, and other organic compounds. Its versatility makes it important in chemical research and manufacturing.
CAS Number | 104-10-9 |
Molecular Formula | C8H11NO |
Purity | ≥95% |
Storage | 3 years -20C powder |
IUPAC Name | 2-(4-aminophenyl)ethanol |
InChI | InChI=1S/C8H11NO/c9-8-3-1-7(2-4-8)5-6-10/h1-4,10H,5-6,9H2 |
InChIKey | QXHDYMUPPXAMPQ-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1CCO)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |