For research use only. Not for therapeutic Use.
2-(4-(Benzyloxy)phenyl)-N,N-dimethylacetamide is an organic compound featuring a benzyloxy-substituted phenyl ring and a dimethylacetamide group. This versatile molecule is used as an intermediate in the synthesis of pharmaceuticals and fine chemicals. Its structure allows for various chemical modifications, making it useful in developing bioactive compounds. The benzyloxy group enhances lipophilicity, while the dimethylacetamide group offers stability in reactions, making it valuable in medicinal chemistry and drug discovery, particularly for creating targeted therapeutic agents.
Catalog Number | R043041 |
CAS Number | 919475-15-3 |
Synonyms | 4-Benzyloxy-N,N-dimethylbenzeneacetamide; N,N-Dimethyl-4-(phenylmethoxy)benzeneacetamide |
Molecular Formula | C17H19NO2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | N,N-dimethyl-2-(4-phenylmethoxyphenyl)acetamide |
InChI | InChI=1S/C17H19NO2/c1-18(2)17(19)12-14-8-10-16(11-9-14)20-13-15-6-4-3-5-7-15/h3-11H,12-13H2,1-2H3 |
InChIKey | FBNGPYZLDKDFFH-UHFFFAOYSA-N |
SMILES | CN(C)C(=O)CC1=CC=C(C=C1)OCC2=CC=CC=C2 |