For research use only. Not for therapeutic Use.
2-(4-Bromo-2-methylphenyl)acetic acid(Cat No.:L033636)is an aromatic carboxylic acid featuring a bromine atom at the 4-position and a methyl group at the 2-position of the phenyl ring. This compound is commonly used in pharmaceutical research and organic synthesis as a versatile intermediate for the development of biologically active molecules and fine chemicals. Its brominated and methyl-substituted structure provides unique reactivity, particularly in cross-coupling and substitution reactions. Researchers in medicinal chemistry utilize this compound for creating novel therapeutic agents and exploring innovative chemical transformations.
CAS Number | 853796-39-1 |
Molecular Formula | C9H9BrO2 |
Purity | ≥95% |
IUPAC Name | 2-(4-bromo-2-methylphenyl)acetic acid |
InChI | InChI=1S/C9H9BrO2/c1-6-4-8(10)3-2-7(6)5-9(11)12/h2-4H,5H2,1H3,(H,11,12) |
InChIKey | PGVPTRWRGZKMDA-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=C1)Br)CC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |