Home
>
Chemical Reagents>Organometallic Reagents> 2-(4-Bromo-2,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
For research use only. Not for therapeutic Use.
2-(4-Bromo-2,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (Cat.No:L003540) is a crucial chemical compound with significant applications in materials science. Its unique molecular structure and boron-containing motif make it a valuable reagent for cross-coupling reactions, particularly in the synthesis of advanced materials and pharmaceuticals.
CAS Number | 924964-16-9 |
Molecular Formula | C14H20BBrO2 |
Purity | ≥95% |
IUPAC Name | 2-(4-bromo-2,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
InChI | InChI=1S/C14H20BBrO2/c1-9-8-12(16)10(2)7-11(9)15-17-13(3,4)14(5,6)18-15/h7-8H,1-6H3 |
InChIKey | ASKNJJQBLNRYAR-UHFFFAOYSA-N |
SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2C)Br)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |