For research use only. Not for therapeutic Use.
2-(4-Bromo-3-chlorophenyl)acetic acid(CAT: L033637) is a halogenated aromatic compound widely used in organic synthesis and medicinal chemistry as an intermediate for producing more complex molecules. The bromine and chlorine substitutions on the phenyl ring enhance the compound’s reactivity, providing multiple sites for further functionalization through coupling or substitution reactions. Its carboxylic acid group allows it to participate in esterification and amidation reactions, making it versatile in synthesizing pharmaceuticals, agrochemicals, and other fine chemicals. The unique structure of 2-(4-Bromo-3-chlorophenyl)acetic acid lends itself to high-precision chemical transformations essential for creating biologically active compounds in advanced research and development.
CAS Number | 1261643-24-6 |
Molecular Formula | C8H6BrClO2 |
Purity | ≥95% |
IUPAC Name | 2-(4-bromo-3-chlorophenyl)acetic acid |
InChI | InChI=1S/C8H6BrClO2/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3H,4H2,(H,11,12) |
InChIKey | RMGCJLITIJXUAB-UHFFFAOYSA-N |