For research use only. Not for therapeutic Use.
2-(4-Bromomethyl)phenylpropionic acid (Cat No.:M011083) is a chemical compound. It comprises a phenyl ring substituted with a bromomethyl group and a propionic acid group. This compound is significant in organic synthesis and chemical research as a building block for creating diverse molecules. The bromomethyl group can serve as a reactive handle for further functionalization. Its structural versatility allows it to participate in various reactions to introduce specific functionalities. The compound’s role as an intermediate contributes to its importance in constructing complex structures for applications in pharmaceuticals, agrochemicals, and materials science.
CAS Number | 111128-12-2 |
Molecular Formula | C10H11BrO2 |
Purity | ≥95% |
Storage | Keep in dark place,Sealed in dry,Room Temperature |
IUPAC Name | 2-[4-(bromomethyl)phenyl]propanoic acid |
InChI | InChI=1S/C10H11BrO2/c1-7(10(12)13)9-4-2-8(6-11)3-5-9/h2-5,7H,6H2,1H3,(H,12,13) |
InChIKey | QQXBRVQJMKBAOZ-UHFFFAOYSA-N |
SMILES | CC(C1=CC=C(C=C1)CBr)C(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |